Products 1391499-01-6
CAS 1391499-01-6 appears in our catalog under these names: (S)-2-Amino-2-(3,4,5-trifluorophenyl)ethan-1-ol (hydrochloride), 95%, 95%, (S)-2-Amino-2-(3,4,5-trifluorophenyl)ethan-1-ol (hydrochloride), 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-2-(3,4,5-trifluorophenyl)ethanol;hydrochloride (CAS 1391499-01-6) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: (2S)-2-amino-2-(3,4,5-trifluorophenyl)ethanol;hydrochloride. InChIKey: DNSYHLZRQMFQCY-OGFXRTJISA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | (2S)-2-amino-2-(3,4,5-trifluorophenyl)ethanol;hydrochloride |
| InChIKey | DNSYHLZRQMFQCY-OGFXRTJISA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)