CAS 1394822-90-2 is the registry number for (R)–2–(1–Amino–2,2,2–trifluoroethyl)phenol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride (CAS 1394822-90-2) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: 2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride. InChIKey: XJEMEBWDQLBNTM-OGFXRTJISA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride |
| InChIKey | XJEMEBWDQLBNTM-OGFXRTJISA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(F)(F)F)N)O.Cl |
Computed by PubChem (NCBI)