Products 1416354-37-4
CAS 1416354-37-4 appears in our catalog under these names: 2–Methyl–4–(trifluoromethyl)pyridine hydrochloride, 2-Methyl-4-(trifluoromethyl)pyridine hydrochloride, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
2-methyl-4-(trifluoromethyl)pyridine;hydrochloride (CAS 1416354-37-4) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 197.58 g/mol. IUPAC name: 2-methyl-4-(trifluoromethyl)pyridine;hydrochloride. InChIKey: RHTMXWVFXWESQF-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 2-methyl-4-(trifluoromethyl)pyridine;hydrochloride |
| InChIKey | RHTMXWVFXWESQF-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)