CAS 2646-97-1 appears in our catalog under these names: 3-(Trifluoromethyl)aniline hydrochloride, 98%, 3-(Trifluoromethyl)aniline hydrochloride, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 500g.
3-(trifluoromethyl)aniline;hydrochloride (CAS 2646-97-1) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 197.58 g/mol. IUPAC name: 3-(trifluoromethyl)aniline;hydrochloride. InChIKey: RGHFRKJSEQEKCV-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 3-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | RGHFRKJSEQEKCV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)