CAS 1846582-40-8 appears in our catalog under these names: (2,4,6-trifluorophenyl)methanamine hydrochloride, 95%, 2,4,6-Trifluorobenzenemethanamine-d4,15N deuterium chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
(2,4,6-trifluorophenyl)methanamine;hydrochloride (CAS 1846582-40-8) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 197.58 g/mol. IUPAC name: (2,4,6-trifluorophenyl)methanamine;hydrochloride. InChIKey: BPDLIQLXMACHLG-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | (2,4,6-trifluorophenyl)methanamine;hydrochloride |
| InChIKey | BPDLIQLXMACHLG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CN)F)F.Cl |
Computed by PubChem (NCBI)