Products 445303-28-6
CAS 445303-28-6 appears in our catalog under these names: 3–(Difluoromethyl)–4–fluoroaniline hydrochloride, 3-(Difluoromethyl)-4-fluoroaniline hydrochloride, 95%, 95%, 3-(DIFLUOROMETHYL)-4-FLUOROANILINE HCL, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-(difluoromethyl)-4-fluoroaniline;hydrochloride (CAS 445303-28-6) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 197.58 g/mol. IUPAC name: 3-(difluoromethyl)-4-fluoroaniline;hydrochloride. InChIKey: YHMBBGQPJORBDM-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 3-(difluoromethyl)-4-fluoroaniline;hydrochloride |
| InChIKey | YHMBBGQPJORBDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)F)F.Cl |
Computed by PubChem (NCBI)