CAS 2567497-10-1 is the registry number for (2,3,4-Trifluorophenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(2,3,4-trifluorophenyl)methanamine;hydrochloride (CAS 2567497-10-1) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 197.58 g/mol. IUPAC name: (2,3,4-trifluorophenyl)methanamine;hydrochloride. InChIKey: MIZRQHCILYKLPF-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | (2,3,4-trifluorophenyl)methanamine;hydrochloride |
| InChIKey | MIZRQHCILYKLPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CN)F)F)F.Cl |
Computed by PubChem (NCBI)