Products 1955530-30-9
CAS 1955530-30-9 is the registry number for 5-(Difluoromethyl)-2-fluoroaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-(difluoromethyl)-2-fluoroaniline;hydrochloride (CAS 1955530-30-9) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 197.58 g/mol. IUPAC name: 5-(difluoromethyl)-2-fluoroaniline;hydrochloride. InChIKey: WQAPEYWCRFSNAR-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 5-(difluoromethyl)-2-fluoroaniline;hydrochloride |
| InChIKey | WQAPEYWCRFSNAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)F)N)F.Cl |
Computed by PubChem (NCBI)