CAS 643088-06-6 appears in our catalog under these names: (2,3,5-Trifluorophenyl)methanamine hydrochloride, 95%, 2,3,5-Trifluorobenzylamine hydrochloride, 2,3,5-Trifluorobenzylamine hydrochloride, min. 95 %, 10 g, 2,3,5-Trifluorobenzylamine hydrochloride, min. 95 %, 25 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 10g, 1g, 25g, 5g.
(2,3,5-trifluorophenyl)methanamine;hydrochloride (CAS 643088-06-6) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 197.58 g/mol. IUPAC name: (2,3,5-trifluorophenyl)methanamine;hydrochloride. InChIKey: AOKAOGFUJFHAJI-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | (2,3,5-trifluorophenyl)methanamine;hydrochloride |
| InChIKey | AOKAOGFUJFHAJI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CN)F)F)F.Cl |
Computed by PubChem (NCBI)