Products 2171837-44-6
CAS 2171837-44-6 is the registry number for 3-(Difluoromethyl)-5-fluoroaniline hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-(difluoromethyl)-5-fluoroaniline;hydrochloride (CAS 2171837-44-6) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 197.58 g/mol. IUPAC name: 3-(difluoromethyl)-5-fluoroaniline;hydrochloride. InChIKey: DKCMVXKVTGZBMG-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 3-(difluoromethyl)-5-fluoroaniline;hydrochloride |
| InChIKey | DKCMVXKVTGZBMG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)F)C(F)F.Cl |
Computed by PubChem (NCBI)