CAS 168644-98-2 is the registry number for (2,4,5-Trifluorophenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
(2,4,5-trifluorophenyl)methanamine;hydrochloride (CAS 168644-98-2) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 197.58 g/mol. IUPAC name: (2,4,5-trifluorophenyl)methanamine;hydrochloride. InChIKey: NJDLNDMDWHEHCW-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | (2,4,5-trifluorophenyl)methanamine;hydrochloride |
| InChIKey | NJDLNDMDWHEHCW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)CN.Cl |
Computed by PubChem (NCBI)