CAS 2732917-43-8 is the registry number for 2,4,6-Trifluorobenzenemethanamine-d4,15N Deuterium Chloride. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
(2H)chlorane;N,N,1,1-tetradeuterio-1-(2,4,6-trifluorophenyl)methan(15N)amine (CAS 2732917-43-8) is a chemical compound with the molecular formula C7H7ClF3N and a molecular weight of 203.61 g/mol. IUPAC name: (2H)chlorane;N,N,1,1-tetradeuterio-1-(2,4,6-trifluorophenyl)methan(15N)amine. InChIKey: BPDLIQLXMACHLG-YZMPXCFISA-N.
| Molecular formula | C7H7ClF3N |
|---|---|
| Molecular weight | 203.61 g/mol |
| IUPAC name | (2H)chlorane;N,N,1,1-tetradeuterio-1-(2,4,6-trifluorophenyl)methan(15N)amine |
| InChIKey | BPDLIQLXMACHLG-YZMPXCFISA-N |
| SMILES | [2H]C([2H])(C1=C(C=C(C=C1F)F)F)[15N]([2H])[2H].[2H]Cl |
Computed by PubChem (NCBI)