Products 1444618-61-4
CAS 1444618-61-4 is the registry number for Dehydrodanshenol A. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
(10S)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)naphtho[1,2-g][1]benzofuran-11-one (CAS 1444618-61-4) is a chemical compound with the molecular formula C21H18O4 and a molecular weight of 334.4 g/mol. IUPAC name: (10S)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)naphtho[1,2-g][1]benzofuran-11-one. InChIKey: WJDNZDJWZBAWCP-NRFANRHFSA-N.
| Molecular formula | C21H18O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (10S)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)naphtho[1,2-g][1]benzofuran-11-one |
| InChIKey | WJDNZDJWZBAWCP-NRFANRHFSA-N |
| SMILES | CC1=C2C=CC3=C(C2=CC=C1)[C@](C(=O)C4=C3OC=C4C)(CC(=O)C)O |
Computed by PubChem (NCBI)
Synonyms:
Dehydrodanshenol A, orb2564163