CAS 38070-93-8 is the registry number for Karanjachromene. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methoxy-8,8-dimethyl-2-phenylpyrano[2,3-f]chromen-4-one (CAS 38070-93-8) is a chemical compound with the molecular formula C21H18O4 and a molecular weight of 334.4 g/mol. IUPAC name: 3-methoxy-8,8-dimethyl-2-phenylpyrano[2,3-f]chromen-4-one. InChIKey: QCLBGWSAIHOGCA-UHFFFAOYSA-N.
| Molecular formula | C21H18O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 3-methoxy-8,8-dimethyl-2-phenylpyrano[2,3-f]chromen-4-one |
| InChIKey | QCLBGWSAIHOGCA-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC3=C2OC(=C(C3=O)OC)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)