CAS 145917-81-3 is the registry number for 1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(1H-indol-3-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1,3-dioxoisoindol-2-yl) 2-(1H-indol-3-yl)acetate (CAS 145917-81-3) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2-(1H-indol-3-yl)acetate. InChIKey: DPOYWOPMHWLHTF-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O4 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2-(1H-indol-3-yl)acetate |
| InChIKey | DPOYWOPMHWLHTF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OC(=O)CC3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)