Products 727980-91-8
CAS 727980-91-8 appears in our catalog under these names: 4-Cyanophenyl 2-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)propanoate, 95%, 4-Cyanophenyl 2-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(4-cyanophenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate (CAS 727980-91-8) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: (4-cyanophenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate. InChIKey: XDZNEGPHEKEUGT-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O4 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | (4-cyanophenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate |
| InChIKey | XDZNEGPHEKEUGT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC1=CC=C(C=C1)C#N)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)