Products 609356-00-5
CAS 609356-00-5 appears in our catalog under these names: 4,6–Di(4–carboxyphenyl)pyrimidine, 4,4'-(Pyrimidine-4,6-diyl)dibenzoic acid, 97%, 97%, 4,6-Di(4-carboxyphenyl)pyrimidine, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-[6-(4-carboxyphenyl)pyrimidin-4-yl]benzoic acid (CAS 609356-00-5) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: 4-[6-(4-carboxyphenyl)pyrimidin-4-yl]benzoic acid. InChIKey: VWTUTWRNJIMOBH-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O4 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 4-[6-(4-carboxyphenyl)pyrimidin-4-yl]benzoic acid |
| InChIKey | VWTUTWRNJIMOBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC=N2)C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)