CAS 938022-16-3 is the registry number for Methyl 6-(2-furyl)-3-phenylisoxazolo(5,4-b)pyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 6-(furan-2-yl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (CAS 938022-16-3) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: methyl 6-(furan-2-yl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate. InChIKey: IARVTPJLTJSEDJ-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O4 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | methyl 6-(furan-2-yl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| InChIKey | IARVTPJLTJSEDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC2=C1C(=NO2)C3=CC=CC=C3)C4=CC=CO4 |
Computed by PubChem (NCBI)