Products 623157-25-5
CAS 623157-25-5 appears in our catalog under these names: 4–(6–(4–Carboxyphenyl)pyrazin–2–yl)benzoic acid, 2，6-Di(4-carboxyphenyl)pyrazine, 95%, 95%, 4-[6-(4-Carboxyphenyl)pyrazin-2-yl]benzoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 100mg, 250mg.
4-[6-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid (CAS 623157-25-5) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: 4-[6-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid. InChIKey: NXUMLHLRQLEKIE-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O4 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 4-[6-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid |
| InChIKey | NXUMLHLRQLEKIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CC(=N2)C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)