CAS 303065-17-0 is the registry number for 1-[2-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)ethyl]-1h-indole-2,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[2-(2,3-dioxoindol-1-yl)ethyl]isoindole-1,3-dione (CAS 303065-17-0) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: 2-[2-(2,3-dioxoindol-1-yl)ethyl]isoindole-1,3-dione. InChIKey: TXVSPUSIUGUYPS-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O4 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 2-[2-(2,3-dioxoindol-1-yl)ethyl]isoindole-1,3-dione |
| InChIKey | TXVSPUSIUGUYPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCN3C4=CC=CC=C4C(=O)C3=O |
Computed by PubChem (NCBI)