Products 623157-24-4

CAS 623157-24-4 is the registry number for 3,3'-(Pyrazine-2,6-diyl)dibenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[6-(3-carboxyphenyl)pyrazin-2-yl]benzoic acid (CAS 623157-24-4) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: 3-[6-(3-carboxyphenyl)pyrazin-2-yl]benzoic acid. InChIKey: YYJKATUYZDEFCP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H12N2O4
Molecular weight320.3 g/mol
IUPAC name3-[6-(3-carboxyphenyl)pyrazin-2-yl]benzoic acid
InChIKeyYYJKATUYZDEFCP-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C2=CN=CC(=N2)C3=CC(=CC=C3)C(=O)O

Computed by PubChem (NCBI)