CAS 1858269-69-8 is the registry number for 2,5-Di(2-pyridyl)terephthalic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2,5-dipyridin-2-ylterephthalic acid (CAS 1858269-69-8) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: 2,5-dipyridin-2-ylterephthalic acid. InChIKey: GYSCDTULDQYKQO-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O4 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 2,5-dipyridin-2-ylterephthalic acid |
| InChIKey | GYSCDTULDQYKQO-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=C(C=C2C(=O)O)C3=CC=CC=N3)C(=O)O |
Computed by PubChem (NCBI)