CAS 901763-85-7 appears in our catalog under these names: Di(pyridin-2-yl) terephthalate, 95%, 1,4-Di2-pyridinyl 1,4-benzenedicarboxylate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
Dipyridin-2-yl benzene-1,4-dicarboxylate (CAS 901763-85-7) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: dipyridin-2-yl benzene-1,4-dicarboxylate. InChIKey: HRTUFIYYGQYPLR-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O4 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | dipyridin-2-yl benzene-1,4-dicarboxylate |
| InChIKey | HRTUFIYYGQYPLR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC(=O)C2=CC=C(C=C2)C(=O)OC3=CC=CC=N3 |
Computed by PubChem (NCBI)