Products 2375195-96-1
CAS 2375195-96-1 appears in our catalog under these names: 2,2'-(1,4-Phenylene)dinicotinic acid, 95%, 2,2'-(1,4-PHENYLENE)DINICOTINIC ACID, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg.
2-[4-(3-carboxy-2-pyridinyl)phenyl]pyridine-3-carboxylic acid (CAS 2375195-96-1) is a chemical compound with the molecular formula C18H12N2O4 and a molecular weight of 320.3 g/mol. IUPAC name: 2-[4-(3-carboxy-2-pyridinyl)phenyl]pyridine-3-carboxylic acid. InChIKey: RCDYXBGXJQPVBC-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O4 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 2-[4-(3-carboxy-2-pyridinyl)phenyl]pyridine-3-carboxylic acid |
| InChIKey | RCDYXBGXJQPVBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=CC=C(C=C2)C3=C(C=CC=N3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)