Products 147008-96-6
CAS 147008-96-6 is the registry number for 6-Chloro-2,3,4,9-tetrahydro-1H-carbazol-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-amine (CAS 147008-96-6) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-amine. InChIKey: BODQGEOXSNZRGK-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| InChIKey | BODQGEOXSNZRGK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1N)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)