Products 148583-69-1
CAS 148583-69-1 appears in our catalog under these names: 3-(Bromomethyl)benzenesulfonyl chloride, 3-Bromomethyl-benzenesulfonyl chloride, 95%, 3-Bromomethylbenzenesulfonyl chloride 95%. Offered by: Biosynth, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 50mg, 250mg.
3-(bromomethyl)benzenesulfonyl chloride (CAS 148583-69-1) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 3-(bromomethyl)benzenesulfonyl chloride. InChIKey: OAYDKDHGBRDMFR-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 3-(bromomethyl)benzenesulfonyl chloride |
| InChIKey | OAYDKDHGBRDMFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)CBr |
Computed by PubChem (NCBI)