Products 1504-68-3
CAS 1504-68-3 is the registry number for Ethyl 3-(2,4-dichlorophenyl)-2-propenoate, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Ethyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate (CAS 1504-68-3) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: ethyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate. InChIKey: LNURJQJBCBYMGG-GQCTYLIASA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | ethyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| InChIKey | LNURJQJBCBYMGG-GQCTYLIASA-N |
| SMILES | CCOC(=O)/C=C/C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)