Products 151157-52-7
CAS 151157-52-7 appears in our catalog under these names: 1-(2-Trifluoromethylphenyl)cyclobutanecarboxylic acid, 1-[2-(Trifluoromethyl)phenyl]cyclobutanecarboxylic Acid, ≥97%, 1-(2-(TRIFLUOROMETHYL)PHENYL)CYCLOBUTANECARBOXYLIC ACID, ≥97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
1-[2-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid (CAS 151157-52-7) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 1-[2-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid. InChIKey: FNOIJSLISHWFEK-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 1-[2-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid |
| InChIKey | FNOIJSLISHWFEK-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=CC=C2C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)