CAS 1518200-63-9 is the registry number for 3-bromo-2,4-difluorobenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg.
3-bromo-2,4-difluorobenzamide (CAS 1518200-63-9) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: 3-bromo-2,4-difluorobenzamide. InChIKey: PDMYDVWHLNLBQE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 3-bromo-2,4-difluorobenzamide |
| InChIKey | PDMYDVWHLNLBQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)N)F)Br)F |
Computed by PubChem (NCBI)