CAS 1541810-83-6 appears in our catalog under these names: 3-Bromo-2,6-difluorobenzamide, 95%, 3-Bromo-2,6-difluorobenzamide, ≥95%, ≥95%, 3-Bromo-2,6-difluorobenzamide. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3-bromo-2,6-difluorobenzamide (CAS 1541810-83-6) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: 3-bromo-2,6-difluorobenzamide. InChIKey: PVFJNNAFSDYDSB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 3-bromo-2,6-difluorobenzamide |
| InChIKey | PVFJNNAFSDYDSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)N)F)Br |
Computed by PubChem (NCBI)