CAS 1805583-47-4 is the registry number for 4-bromo-2,3-difluorobenzamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
4-bromo-2,3-difluorobenzamide (CAS 1805583-47-4) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: 4-bromo-2,3-difluorobenzamide. InChIKey: BOBGOLVWNOSVMG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 4-bromo-2,3-difluorobenzamide |
| InChIKey | BOBGOLVWNOSVMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)N)F)F)Br |
Computed by PubChem (NCBI)