CAS 2567042-39-9 is the registry number for 2-Bromo-1-(3,5-difluoropyridin-2-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(3,5-difluoro-2-pyridinyl)ethanone (CAS 2567042-39-9) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: 2-bromo-1-(3,5-difluoro-2-pyridinyl)ethanone. InChIKey: HZAAXFPZKKFIAF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 2-bromo-1-(3,5-difluoro-2-pyridinyl)ethanone |
| InChIKey | HZAAXFPZKKFIAF-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)C(=O)CBr)F |
Computed by PubChem (NCBI)