CAS 1626337-90-3 appears in our catalog under these names: 5-Bromo-2,3-difluorobenzamide, 98%, 5-Bromo-2,3-difluorobenzamide, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
5-bromo-2,3-difluorobenzamide (CAS 1626337-90-3) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: 5-bromo-2,3-difluorobenzamide. InChIKey: GPOZYURDVJMILC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 5-bromo-2,3-difluorobenzamide |
| InChIKey | GPOZYURDVJMILC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)N)F)F)Br |
Computed by PubChem (NCBI)