CAS 764648-42-2 appears in our catalog under these names: 4-Bromo-2,5-difluorobenzamide, 96%, 4-Bromo-2,5-difluorobenzamide, 97%, 4-Bromo-2,5-difluorobenzamide, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 25g, 100mg.
4-bromo-2,5-difluorobenzamide (CAS 764648-42-2) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: 4-bromo-2,5-difluorobenzamide. InChIKey: QEXQXWQSPGXPDH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 4-bromo-2,5-difluorobenzamide |
| InChIKey | QEXQXWQSPGXPDH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)C(=O)N |
Computed by PubChem (NCBI)