Products 2228555-58-4
CAS 2228555-58-4 is the registry number for 1-(6-Bromopyridin-3-yl)-2,2-difluoroethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-bromo-3-pyridinyl)-2,2-difluoroethanone (CAS 2228555-58-4) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: 1-(6-bromo-3-pyridinyl)-2,2-difluoroethanone. InChIKey: KUMGDNGLUOEQPH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 1-(6-bromo-3-pyridinyl)-2,2-difluoroethanone |
| InChIKey | KUMGDNGLUOEQPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)C(F)F)Br |
Computed by PubChem (NCBI)