Products 2755730-56-2
CAS 2755730-56-2 is the registry number for (E)-3-bromo-2,6-difluorobenzaldehyde oxime, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(NE)-N-[(3-bromo-2,6-difluorophenyl)methylidene]hydroxylamine (CAS 2755730-56-2) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: (NE)-N-[(3-bromo-2,6-difluorophenyl)methylidene]hydroxylamine. InChIKey: ODMUOLHLFVAUMP-QDEBKDIKSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | (NE)-N-[(3-bromo-2,6-difluorophenyl)methylidene]hydroxylamine |
| InChIKey | ODMUOLHLFVAUMP-QDEBKDIKSA-N |
| SMILES | C1=CC(=C(C(=C1F)/C=N/O)F)Br |
Computed by PubChem (NCBI)