Products 2229231-69-8
CAS 2229231-69-8 is the registry number for 1-(6-Bromo-2-pyridinyl)-2,2-difluoroethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
1-(6-bromo-2-pyridinyl)-2,2-difluoroethanone (CAS 2229231-69-8) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: 1-(6-bromo-2-pyridinyl)-2,2-difluoroethanone. InChIKey: DTKYQODOMHNCGU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 1-(6-bromo-2-pyridinyl)-2,2-difluoroethanone |
| InChIKey | DTKYQODOMHNCGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)C(=O)C(F)F |
Computed by PubChem (NCBI)