CAS 840481-49-4 appears in our catalog under these names: 4-Bromo-2,6-difluorobenzamide, 4-Bromo-2,6-difluorobenzamide, 95%, 4-Bromo-2,6-difluorobenzamide 98%, 4-Bromo-2,6-difluoro-benzamide, 4-Bromo-2,6-difluorobenzamide, 98%, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 0,5g, 100mg, 10g, 1g, 250mg, 25g, 100g.
4-bromo-2,6-difluorobenzamide (CAS 840481-49-4) is a chemical compound with the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. IUPAC name: 4-bromo-2,6-difluorobenzamide. InChIKey: VYGSRKKGNFFTNB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 4-bromo-2,6-difluorobenzamide |
| InChIKey | VYGSRKKGNFFTNB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)N)F)Br |
Computed by PubChem (NCBI)