Products 1522115-36-1
CAS 1522115-36-1 appears in our catalog under these names: (4-Chloro-3-methylphenyl)methanesulfonyl chloride, 95%, 95%, (4-CHLORO-3-METHYLPHENYL)METHANESULFONYL CHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4-chloro-3-methylphenyl)methanesulfonyl chloride (CAS 1522115-36-1) is a chemical compound with the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. IUPAC name: (4-chloro-3-methylphenyl)methanesulfonyl chloride. InChIKey: OIWQZLQYWYCVCP-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2S |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | (4-chloro-3-methylphenyl)methanesulfonyl chloride |
| InChIKey | OIWQZLQYWYCVCP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CS(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)