Products 1610060-59-7
CAS 1610060-59-7 is the registry number for 2-Bromo-6-fluoro-4-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-6-fluoro-4-nitrobenzoic acid (CAS 1610060-59-7) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 2-bromo-6-fluoro-4-nitrobenzoic acid. InChIKey: RLLZDZKCCNTZDW-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 2-bromo-6-fluoro-4-nitrobenzoic acid |
| InChIKey | RLLZDZKCCNTZDW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-6-fluoro-4-nitrobenzoic acid