CAS 163295-71-4 appears in our catalog under these names: (2,5–Dichlorophenyl)methanesulfonyl chloride, (2,5-Dichlorophenyl)methanesulphonyl chloride, (2,5-Dichlorophenyl)methanesulfonyl chloride, 95%. Offered by: GLPBio, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g.
(2,5-dichlorophenyl)methanesulfonyl chloride (CAS 163295-71-4) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: (2,5-dichlorophenyl)methanesulfonyl chloride. InChIKey: DHIDMPXMRCSOHM-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | (2,5-dichlorophenyl)methanesulfonyl chloride |
| InChIKey | DHIDMPXMRCSOHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CS(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)