CAS 1702688-50-3 is the registry number for 4-(Chloromethyl)-1-(4-methylbenzyl)-1H-imidazole. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
4-(chloromethyl)-1-[(4-methylphenyl)methyl]imidazole (CAS 1702688-50-3) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 4-(chloromethyl)-1-[(4-methylphenyl)methyl]imidazole. InChIKey: QSGBVMOTHXLOLY-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 4-(chloromethyl)-1-[(4-methylphenyl)methyl]imidazole |
| InChIKey | QSGBVMOTHXLOLY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C=C(N=C2)CCl |
Computed by PubChem (NCBI)