CAS 17356-61-5 is the registry number for 1-(3,4-Dichlorophenyl)-3-methoxyurea. Offered by: Dr. Ehrenstorfer. Available pack sizes: 50mg.
1-(3,4-dichlorophenyl)-3-methoxyurea (CAS 17356-61-5) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-3-methoxyurea. InChIKey: QDSJDNUSIBDVMS-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-3-methoxyurea |
| InChIKey | QDSJDNUSIBDVMS-UHFFFAOYSA-N |
| SMILES | CONC(=O)NC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)