CAS 175358-02-8 appears in our catalog under these names: 4,6–dichloropyrido(3,2–d)pyrimidine, 4,6-Dichloropyrido[3,2-d]pyrimidine, 97%, 97%, 4,6-Dichloropyrido[3,2-d]pyrimidine, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
4,6-dichloropyrido[3,2-d]pyrimidine (CAS 175358-02-8) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 4,6-dichloropyrido[3,2-d]pyrimidine. InChIKey: FCNJEINFWXOLQY-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 4,6-dichloropyrido[3,2-d]pyrimidine |
| InChIKey | FCNJEINFWXOLQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=CN=C2Cl)Cl |
Computed by PubChem (NCBI)