Products 1782832-99-8
CAS 1782832-99-8 appears in our catalog under these names: 4–Bromo–3，5–difluorophenylacetic acid, 4-Bromo-3,5-difluorophenylacetic acid, 95%, 95%, 4-Bromo-3,5-difluorophenylacetic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
2-(4-bromo-3,5-difluorophenyl)acetic acid (CAS 1782832-99-8) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(4-bromo-3,5-difluorophenyl)acetic acid. InChIKey: FENXBFUKGKJYMX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(4-bromo-3,5-difluorophenyl)acetic acid |
| InChIKey | FENXBFUKGKJYMX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Br)F)CC(=O)O |
Computed by PubChem (NCBI)