CAS 178444-98-9 is the registry number for 4-Bromo-2,5-difluoro-3-methylbenzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-2,5-difluoro-3-methylbenzoic acid (CAS 178444-98-9) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 4-bromo-2,5-difluoro-3-methylbenzoic acid. InChIKey: QKRJZGHIXGLFDX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 4-bromo-2,5-difluoro-3-methylbenzoic acid |
| InChIKey | QKRJZGHIXGLFDX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Br)F)C(=O)O)F |
Computed by PubChem (NCBI)