Products 1805537-77-2
CAS 1805537-77-2 appears in our catalog under these names: 2-(2-Bromo-3,6-difluorophenyl)acetic acid, 98%, 2-(2-Bromo-3,6-difluorophenyl)acetic acid, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-(2-bromo-3,6-difluorophenyl)acetic acid (CAS 1805537-77-2) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(2-bromo-3,6-difluorophenyl)acetic acid. InChIKey: LXRZXACOBCBZNS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(2-bromo-3,6-difluorophenyl)acetic acid |
| InChIKey | LXRZXACOBCBZNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)CC(=O)O)Br)F |
Computed by PubChem (NCBI)