CAS 207118-08-9 appears in our catalog under these names: Boc-D-Ala(CF3)-OH 98%, (R)-2-((tert-Butoxycarbonyl)amino)-4,4,4-trifluorobutanoic acid, 98%, 98%, (R)-Boc-2-amino-4,4,4-trifluoro-butyric acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2R)-4,4,4-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 207118-08-9) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: (2R)-4,4,4-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: UCUKFQMRNHNNQY-RXMQYKEDSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | (2R)-4,4,4-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | UCUKFQMRNHNNQY-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)