Products 1821364-93-5
CAS 1821364-93-5 is the registry number for 1-(4-chlorophenyl)-2,2-difluoropropan-1-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-chlorophenyl)-2,2-difluoropropan-1-one (CAS 1821364-93-5) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,2-difluoropropan-1-one. InChIKey: QWNPDPAAIQQSHX-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,2-difluoropropan-1-one |
| InChIKey | QWNPDPAAIQQSHX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Cl)(F)F |
Computed by PubChem (NCBI)