CAS 20035-42-1 is the registry number for 2,3-Dibromo-6-hydroxy-5-methoxybenzaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,3-dibromo-6-hydroxy-5-methoxybenzaldehyde (CAS 20035-42-1) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2,3-dibromo-6-hydroxy-5-methoxybenzaldehyde. InChIKey: NEQRDPRMCZPVJM-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O3 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | 2,3-dibromo-6-hydroxy-5-methoxybenzaldehyde |
| InChIKey | NEQRDPRMCZPVJM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1O)C=O)Br)Br |
Computed by PubChem (NCBI)